C21H21Cl2FN6O — CID 58688098
3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(2-piperazin-1-ylpyrimidin-5-yl)pyridin-2-amine (PubChem CID 58688098) has the molecular formula C21H21Cl2FN6O and a molecular weight of 463.34 g/mol. Its IUPAC name is 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(2-piperazin-1-ylpyrimidin-5-yl)pyridin-2-amine.
| Compound Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(2-piperazin-1-ylpyrimidin-5-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 58688098 |
| Molecular Formula | C21H21Cl2FN6O |
| Molecular Weight | 463.34 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(2-piperazin-1-ylpyrimidin-5-yl)pyridin-2-amine |
| SMILES | CC(Oc1cc(-c2cnc(N3CCNCC3)nc2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C21H21Cl2FN6O/c1-12(18-15(22)2-3-16(24)19(18)23)31-17-8-13(9-27-20(17)25)14-10-28-21(29-11-14)30-6-4-26-5-7-30/h2-3,8-12,26H,4-7H2,1H3,(H2,25,27) |
| InChIKey | IRRDWRHHMNMVSU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.34 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|