C25H25Cl2FN4O3 — CID 58688179
[4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-2-methoxyphenyl]-piperazin-1-ylmethanone (PubChem CID 58688179) has the molecular formula C25H25Cl2FN4O3 and a molecular weight of 519.40 g/mol. Its IUPAC name is [4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-2-methoxyphenyl]-piperazin-1-ylmethanone.
| Compound Name | [4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-2-methoxyphenyl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 58688179 |
| Molecular Formula | C25H25Cl2FN4O3 |
| Molecular Weight | 519.40 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | [4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-2-methoxyphenyl]-piperazin-1-ylmethanone |
| SMILES | COc1cc(-c2cnc(N)c(OC(C)c3c(Cl)ccc(F)c3Cl)c2)ccc1C(=O)N1CCNCC1 |
| InChI | InChI=1S/C25H25Cl2FN4O3/c1-14(22-18(26)5-6-19(28)23(22)27)35-21-12-16(13-31-24(21)29)15-3-4-17(20(11-15)34-2)25(33)32-9-7-30-8-10-32/h3-6,11-14,30H,7-10H2,1-2H3,(H2,29,31) |
| InChIKey | JSFFLESDVUGLGQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.40 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|