C27H23Cl2FN4O2 — CID 58885899
4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N-(2-pyridin-3-ylethyl)benzamide (PubChem CID 58885899) has the molecular formula C27H23Cl2FN4O2 and a molecular weight of 525.41 g/mol. Its IUPAC name is 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N-(2-pyridin-3-ylethyl)benzamide.
| Compound Name | 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N-(2-pyridin-3-ylethyl)benzamide |
|---|---|
| PubChem CID | 58885899 |
| Molecular Formula | C27H23Cl2FN4O2 |
| Molecular Weight | 525.41 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N-(2-pyridin-3-ylethyl)benzamide |
| SMILES | CC(Oc1cc(-c2ccc(C(=O)NCCc3cccnc3)cc2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C27H23Cl2FN4O2/c1-16(24-21(28)8-9-22(30)25(24)29)36-23-13-20(15-34-26(23)31)18-4-6-19(7-5-18)27(35)33-12-10-17-3-2-11-32-14-17/h2-9,11,13-16H,10,12H2,1H3,(H2,31,34)(H,33,35) |
| InChIKey | PMQBNBUWVOPCGZ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.41 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|