C22H24Cl2FN5O2 — CID 58688166
3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(2-morpholin-4-ylethyl)imidazol-4-yl]pyridin-2-amine (PubChem CID 58688166) has the molecular formula C22H24Cl2FN5O2 and a molecular weight of 480.37 g/mol. Its IUPAC name is 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(2-morpholin-4-ylethyl)imidazol-4-yl]pyridin-2-amine.
| Compound Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(2-morpholin-4-ylethyl)imidazol-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 58688166 |
| Molecular Formula | C22H24Cl2FN5O2 |
| Molecular Weight | 480.37 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(2-morpholin-4-ylethyl)imidazol-4-yl]pyridin-2-amine |
| SMILES | CC(Oc1cc(-c2cn(CCN3CCOCC3)cn2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C22H24Cl2FN5O2/c1-14(20-16(23)2-3-17(25)21(20)24)32-19-10-15(11-27-22(19)26)18-12-30(13-28-18)5-4-29-6-8-31-9-7-29/h2-3,10-14H,4-9H2,1H3,(H2,26,27) |
| InChIKey | NFFJTXYKAWJSTK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|