C21H22Cl2FN3O2 — CID 72706719
3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(3-morpholin-4-ylbut-1-ynyl)pyridin-2-amine (PubChem CID 72706719) has the molecular formula C21H22Cl2FN3O2 and a molecular weight of 438.33 g/mol. Its IUPAC name is 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(3-morpholin-4-ylbut-1-ynyl)pyridin-2-amine.
| Compound Name | 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(3-morpholin-4-ylbut-1-ynyl)pyridin-2-amine |
|---|---|
| PubChem CID | 72706719 |
| Molecular Formula | C21H22Cl2FN3O2 |
| Molecular Weight | 438.33 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(3-morpholin-4-ylbut-1-ynyl)pyridin-2-amine |
| SMILES | CC(C#Cc1cnc(N)c(O[C@H](C)c2c(Cl)ccc(F)c2Cl)c1)N1CCOCC1 |
| InChI | InChI=1S/C21H22Cl2FN3O2/c1-13(27-7-9-28-10-8-27)3-4-15-11-18(21(25)26-12-15)29-14(2)19-16(22)5-6-17(24)20(19)23/h5-6,11-14H,7-10H2,1-2H3,(H2,25,26)/t13?,14-/m1/s1 |
| InChIKey | GSJGIHUMLSFOFI-ARLHGKGLSA-N |
| XLogP | 4.32 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.33 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|