C16H12Cl2FN3O2 — CID 69459031
3-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]prop-2-ynamide (PubChem CID 69459031) has the molecular formula C16H12Cl2FN3O2 and a molecular weight of 368.20 g/mol. Its IUPAC name is 3-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]prop-2-ynamide.
| Compound Name | 3-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]prop-2-ynamide |
|---|---|
| PubChem CID | 69459031 |
| Molecular Formula | C16H12Cl2FN3O2 |
| Molecular Weight | 368.20 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | 3-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]prop-2-ynamide |
| SMILES | CC(Oc1cc(C#CC(N)=O)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C16H12Cl2FN3O2/c1-8(14-10(17)3-4-11(19)15(14)18)24-12-6-9(2-5-13(20)23)7-22-16(12)21/h3-4,6-8H,1H3,(H2,20,23)(H2,21,22) |
| InChIKey | BDVQDSUPKGMAOW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.20 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|