C13H10Cl2FN3O3 — CID 67075849
6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazine-3-carboxylic acid (PubChem CID 67075849) has the molecular formula C13H10Cl2FN3O3 and a molecular weight of 346.15 g/mol. Its IUPAC name is 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazine-3-carboxylic acid.
| Compound Name | 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 67075849 |
| Molecular Formula | C13H10Cl2FN3O3 |
| Molecular Weight | 346.15 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazine-3-carboxylic acid |
| SMILES | CC(Oc1cc(C(=O)O)nnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C13H10Cl2FN3O3/c1-5(10-6(14)2-3-7(16)11(10)15)22-9-4-8(13(20)21)18-19-12(9)17/h2-5H,1H3,(H2,17,19)(H,20,21) |
| InChIKey | ORPAQUJHZZZPSH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.15 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|