C25H28Cl2FN5O2 — CID 24959658
4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]-N-[2-(diethylamino)ethyl]benzamide (PubChem CID 24959658) has the molecular formula C25H28Cl2FN5O2 and a molecular weight of 520.44 g/mol. Its IUPAC name is 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]-N-[2-(diethylamino)ethyl]benzamide.
| Compound Name | 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]-N-[2-(diethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 24959658 |
| Molecular Formula | C25H28Cl2FN5O2 |
| Molecular Weight | 520.44 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]-N-[2-(diethylamino)ethyl]benzamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(-c2cc(OC(C)c3c(Cl)ccc(F)c3Cl)c(N)nn2)cc1 |
| InChI | InChI=1S/C25H28Cl2FN5O2/c1-4-33(5-2)13-12-30-25(34)17-8-6-16(7-9-17)20-14-21(24(29)32-31-20)35-15(3)22-18(26)10-11-19(28)23(22)27/h6-11,14-15H,4-5,12-13H2,1-3H3,(H2,29,32)(H,30,34) |
| InChIKey | GDLPJMGKQMWNPL-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.44 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|