C28H30Cl2FN5O3 — CID 24959660
[4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]phenyl]-(4-morpholin-4-ylpiperidin-1-yl)methanone (PubChem CID 24959660) has the molecular formula C28H30Cl2FN5O3 and a molecular weight of 574.48 g/mol. Its IUPAC name is [4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]phenyl]-(4-morpholin-4-ylpiperidin-1-yl)methanone.
| Compound Name | [4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]phenyl]-(4-morpholin-4-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 24959660 |
| Molecular Formula | C28H30Cl2FN5O3 |
| Molecular Weight | 574.48 g/mol |
| Exact Mass | 573.17 |
| IUPAC Name | [4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]phenyl]-(4-morpholin-4-ylpiperidin-1-yl)methanone |
| SMILES | CC(Oc1cc(-c2ccc(C(=O)N3CCC(N4CCOCC4)CC3)cc2)nnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C28H30Cl2FN5O3/c1-17(25-21(29)6-7-22(31)26(25)30)39-24-16-23(33-34-27(24)32)18-2-4-19(5-3-18)28(37)36-10-8-20(9-11-36)35-12-14-38-15-13-35/h2-7,16-17,20H,8-15H2,1H3,(H2,32,34) |
| InChIKey | YJPFLWLIISFWBX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.48 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|