C27H29Cl2FN4O — CID 143725041
4-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-6-[4-(4-methylcycloheptanecarboximidoyl)phenyl]pyridazin-3-amine (PubChem CID 143725041) has the molecular formula C27H29Cl2FN4O and a molecular weight of 515.46 g/mol. Its IUPAC name is 4-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-6-[4-(4-methylcycloheptanecarboximidoyl)phenyl]pyridazin-3-amine.
| Compound Name | 4-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-6-[4-(4-methylcycloheptanecarboximidoyl)phenyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 143725041 |
| Molecular Formula | C27H29Cl2FN4O |
| Molecular Weight | 515.46 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | 4-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-6-[4-(4-methylcycloheptanecarboximidoyl)phenyl]pyridazin-3-amine |
| SMILES | [H]/N=C(\c1ccc(-c2cc(OC(C)c3c(Cl)ccc(F)c3Cl)c(N)nn2)cc1)C1CCCC(C)CC1 |
| InChI | InChI=1S/C27H29Cl2FN4O/c1-15-4-3-5-18(7-6-15)26(31)19-10-8-17(9-11-19)22-14-23(27(32)34-33-22)35-16(2)24-20(28)12-13-21(30)25(24)29/h8-16,18,31H,3-7H2,1-2H3,(H2,32,34)/b31-26- |
| InChIKey | UBRUWILKVWTHIW-ZXPTYKNPSA-N |
| XLogP | 7.90 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.46 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|