C26H27Cl2FN6O3 — CID 123184420
N-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]-4-benzoyl-2,2-dimethylpiperazine-1-carboxamide (PubChem CID 123184420) has the molecular formula C26H27Cl2FN6O3 and a molecular weight of 561.45 g/mol. Its IUPAC name is N-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]-4-benzoyl-2,2-dimethylpiperazine-1-carboxamide.
| Compound Name | N-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]-4-benzoyl-2,2-dimethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 123184420 |
| Molecular Formula | C26H27Cl2FN6O3 |
| Molecular Weight | 561.45 g/mol |
| Exact Mass | 560.15 |
| IUPAC Name | N-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]-4-benzoyl-2,2-dimethylpiperazine-1-carboxamide |
| SMILES | C[C@@H](Oc1cc(NC(=O)N2CCN(C(=O)c3ccccc3)CC2(C)C)nnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C26H27Cl2FN6O3/c1-15(21-17(27)9-10-18(29)22(21)28)38-19-13-20(32-33-23(19)30)31-25(37)35-12-11-34(14-26(35,2)3)24(36)16-7-5-4-6-8-16/h4-10,13,15H,11-12,14H2,1-3H3,(H2,30,33)(H,31,32,37)/t15-/m1/s1 |
| InChIKey | IYWZLJSKSVIUGT-OAHLLOKOSA-N |
| XLogP | 5.41 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.45 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|