C27H28Cl2FN6O3+ — CID 123336494
N-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]-2-benzoyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ium-2-carboxamide (PubChem CID 123336494) has the molecular formula C27H28Cl2FN6O3+ and a molecular weight of 574.46 g/mol. Its IUPAC name is N-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]-2-benzoyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ium-2-carboxamide.
| Compound Name | N-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]-2-benzoyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ium-2-carboxamide |
|---|---|
| PubChem CID | 123336494 |
| Molecular Formula | C27H28Cl2FN6O3+ |
| Molecular Weight | 574.46 g/mol |
| Exact Mass | 573.16 |
| IUPAC Name | N-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]-2-benzoyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ium-2-carboxamide |
| SMILES | C[C@@H](Oc1cc(NC(=O)[N+]2(C(=O)c3ccccc3)CCN3CCCC3C2)nnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C27H27Cl2FN6O3/c1-16(23-19(28)9-10-20(30)24(23)29)39-21-14-22(33-34-25(21)31)32-27(38)36(26(37)17-6-3-2-4-7-17)13-12-35-11-5-8-18(35)15-36/h2-4,6-7,9-10,14,16,18H,5,8,11-13,15H2,1H3,(H2-,31,32,33,34,38)/p+1/t16-,18?,36?/m1/s1 |
| InChIKey | MWSGBEAPCDNZDC-YRJONXDPSA-O |
| XLogP | 5.31 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.46 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|