C27H27Cl2FN6O — CID 71664252
5-[1-(1-benzylpiperidin-4-yl)triazol-4-yl]-3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine (PubChem CID 71664252) has the molecular formula C27H27Cl2FN6O and a molecular weight of 541.46 g/mol. Its IUPAC name is 5-[1-(1-benzylpiperidin-4-yl)triazol-4-yl]-3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine.
| Compound Name | 5-[1-(1-benzylpiperidin-4-yl)triazol-4-yl]-3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine |
|---|---|
| PubChem CID | 71664252 |
| Molecular Formula | C27H27Cl2FN6O |
| Molecular Weight | 541.46 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | 5-[1-(1-benzylpiperidin-4-yl)triazol-4-yl]-3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine |
| SMILES | CC(Oc1cc(-c2cn(C3CCN(Cc4ccccc4)CC3)nn2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C27H27Cl2FN6O/c1-17(25-21(28)7-8-22(30)26(25)29)37-24-13-19(14-32-27(24)31)23-16-36(34-33-23)20-9-11-35(12-10-20)15-18-5-3-2-4-6-18/h2-8,13-14,16-17,20H,9-12,15H2,1H3,(H2,31,32) |
| InChIKey | KVVZFLKZRFXHCK-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.46 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|