C25H26Cl2FN6O3+ — CID 123318034
N-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]-1-benzoyl-4-methylpiperazin-1-ium-1-carboxamide (PubChem CID 123318034) has the molecular formula C25H26Cl2FN6O3+ and a molecular weight of 548.43 g/mol. Its IUPAC name is N-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]-1-benzoyl-4-methylpiperazin-1-ium-1-carboxamide.
| Compound Name | N-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]-1-benzoyl-4-methylpiperazin-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 123318034 |
| Molecular Formula | C25H26Cl2FN6O3+ |
| Molecular Weight | 548.43 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | N-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]-1-benzoyl-4-methylpiperazin-1-ium-1-carboxamide |
| SMILES | C[C@@H](Oc1cc(NC(=O)[N+]2(C(=O)c3ccccc3)CCN(C)CC2)nnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C25H25Cl2FN6O3/c1-15(21-17(26)8-9-18(28)22(21)27)37-19-14-20(31-32-23(19)29)30-25(36)34(12-10-33(2)11-13-34)24(35)16-6-4-3-5-7-16/h3-9,14-15H,10-13H2,1-2H3,(H2-,29,30,31,32,36)/p+1/t15-/m1/s1 |
| InChIKey | DVZBSKDIYYKTTN-OAHLLOKOSA-O |
| XLogP | 4.78 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|