C22H25Cl2FN4O — CID 72706720
3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[3-(4-methylpiperazin-1-yl)but-1-ynyl]pyridin-2-amine (PubChem CID 72706720) has the molecular formula C22H25Cl2FN4O and a molecular weight of 451.37 g/mol. Its IUPAC name is 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[3-(4-methylpiperazin-1-yl)but-1-ynyl]pyridin-2-amine.
| Compound Name | 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[3-(4-methylpiperazin-1-yl)but-1-ynyl]pyridin-2-amine |
|---|---|
| PubChem CID | 72706720 |
| Molecular Formula | C22H25Cl2FN4O |
| Molecular Weight | 451.37 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[3-(4-methylpiperazin-1-yl)but-1-ynyl]pyridin-2-amine |
| SMILES | CC(C#Cc1cnc(N)c(O[C@H](C)c2c(Cl)ccc(F)c2Cl)c1)N1CCN(C)CC1 |
| InChI | InChI=1S/C22H25Cl2FN4O/c1-14(29-10-8-28(3)9-11-29)4-5-16-12-19(22(26)27-13-16)30-15(2)20-17(23)6-7-18(25)21(20)24/h6-7,12-15H,8-11H2,1-3H3,(H2,26,27)/t14?,15-/m1/s1 |
| InChIKey | BSNLPOOYGJRXOT-YSSOQSIOSA-N |
| XLogP | 4.24 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|