C21H24Cl2N4O — CID 72706848
3-[(1R)-1-(2,6-dichlorophenyl)ethoxy]-5-(3-piperazin-1-ylbut-1-ynyl)pyridin-2-amine (PubChem CID 72706848) has the molecular formula C21H24Cl2N4O and a molecular weight of 419.36 g/mol. Its IUPAC name is 3-[(1R)-1-(2,6-dichlorophenyl)ethoxy]-5-(3-piperazin-1-ylbut-1-ynyl)pyridin-2-amine.
| Compound Name | 3-[(1R)-1-(2,6-dichlorophenyl)ethoxy]-5-(3-piperazin-1-ylbut-1-ynyl)pyridin-2-amine |
|---|---|
| PubChem CID | 72706848 |
| Molecular Formula | C21H24Cl2N4O |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 3-[(1R)-1-(2,6-dichlorophenyl)ethoxy]-5-(3-piperazin-1-ylbut-1-ynyl)pyridin-2-amine |
| SMILES | CC(C#Cc1cnc(N)c(O[C@H](C)c2c(Cl)cccc2Cl)c1)N1CCNCC1 |
| InChI | InChI=1S/C21H24Cl2N4O/c1-14(27-10-8-25-9-11-27)6-7-16-12-19(21(24)26-13-16)28-15(2)20-17(22)4-3-5-18(20)23/h3-5,12-15,25H,8-11H2,1-2H3,(H2,24,26)/t14?,15-/m1/s1 |
| InChIKey | DFNPEWWQFQTZOS-YSSOQSIOSA-N |
| XLogP | 3.76 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|