C34H25Cl2FN2OSi — CID 174733462
CID 174733462 (PubChem CID 174733462) has the molecular formula C34H25Cl2FN2OSi and a molecular weight of 595.58 g/mol.
| Compound Name | CID 174733462 |
|---|---|
| PubChem CID | 174733462 |
| Molecular Formula | C34H25Cl2FN2OSi |
| Molecular Weight | 595.58 g/mol |
| Exact Mass | 594.11 |
| IUPAC Name | — |
| SMILES | CC(Oc1cc(C#C[Si]C(c2ccccc2)(c2ccccc2)c2ccccc2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C34H25Cl2FN2OSi/c1-23(31-28(35)17-18-29(37)32(31)36)40-30-21-24(22-39-33(30)38)19-20-41-34(25-11-5-2-6-12-25,26-13-7-3-8-14-26)27-15-9-4-10-16-27/h2-18,21-23H,1H3,(H2,38,39) |
| InChIKey | YSBKXLZPKOXIJQ-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.58 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|