C15H15Cl2FN2O3 — CID 21111371
1-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]ethane-1,2-diol (PubChem CID 21111371) has the molecular formula C15H15Cl2FN2O3 and a molecular weight of 361.20 g/mol. Its IUPAC name is 1-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]ethane-1,2-diol.
| Compound Name | 1-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]ethane-1,2-diol |
|---|---|
| PubChem CID | 21111371 |
| Molecular Formula | C15H15Cl2FN2O3 |
| Molecular Weight | 361.20 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 1-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]ethane-1,2-diol |
| SMILES | C[C@@H](Oc1cc(C(O)CO)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C15H15Cl2FN2O3/c1-7(13-9(16)2-3-10(18)14(13)17)23-12-4-8(11(22)6-21)5-20-15(12)19/h2-5,7,11,21-22H,6H2,1H3,(H2,19,20)/t7-,11?/m1/s1 |
| InChIKey | UGFQRCLAFXAJJF-DKSCNQEISA-N |
| XLogP | 3.28 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.20 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|