C15H15Cl2FN2O — CID 143190028
3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-ethylpyridin-2-amine (PubChem CID 143190028) has the molecular formula C15H15Cl2FN2O and a molecular weight of 329.20 g/mol. Its IUPAC name is 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-ethylpyridin-2-amine.
| Compound Name | 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-ethylpyridin-2-amine |
|---|---|
| PubChem CID | 143190028 |
| Molecular Formula | C15H15Cl2FN2O |
| Molecular Weight | 329.20 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-ethylpyridin-2-amine |
| SMILES | CCc1cnc(N)c(O[C@H](C)c2c(Cl)ccc(F)c2Cl)c1 |
| InChI | InChI=1S/C15H15Cl2FN2O/c1-3-9-6-12(15(19)20-7-9)21-8(2)13-10(16)4-5-11(18)14(13)17/h4-8H,3H2,1-2H3,(H2,19,20)/t8-/m1/s1 |
| InChIKey | TXEQKYUPFKBWLZ-MRVPVSSYSA-N |
| XLogP | 4.81 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.20 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|