C13H12Cl2N2O — CID 141396970
3-[(1R)-1-(2,6-dichlorophenyl)ethoxy]pyridin-2-amine (PubChem CID 141396970) has the molecular formula C13H12Cl2N2O and a molecular weight of 283.16 g/mol. Its IUPAC name is 3-[(1R)-1-(2,6-dichlorophenyl)ethoxy]pyridin-2-amine.
| Compound Name | 3-[(1R)-1-(2,6-dichlorophenyl)ethoxy]pyridin-2-amine |
|---|---|
| PubChem CID | 141396970 |
| Molecular Formula | C13H12Cl2N2O |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 3-[(1R)-1-(2,6-dichlorophenyl)ethoxy]pyridin-2-amine |
| SMILES | C[C@@H](Oc1cccnc1N)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H12Cl2N2O/c1-8(12-9(14)4-2-5-10(12)15)18-11-6-3-7-17-13(11)16/h2-8H,1H3,(H2,16,17)/t8-/m1/s1 |
| InChIKey | RDGBXTNLGPONID-MRVPVSSYSA-N |
| XLogP | 4.11 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |