C14H16ClN3O2 — CID 103445899
[(3-chloro-2-pyridinyl)-(2,6-dimethoxyphenyl)methyl]hydrazine (PubChem CID 103445899) has the molecular formula C14H16ClN3O2 and a molecular weight of 293.75 g/mol. Its IUPAC name is [(3-chloro-2-pyridinyl)-(2,6-dimethoxyphenyl)methyl]hydrazine.
| Compound Name | [(3-chloro-2-pyridinyl)-(2,6-dimethoxyphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 103445899 |
| Molecular Formula | C14H16ClN3O2 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | [(3-chloro-2-pyridinyl)-(2,6-dimethoxyphenyl)methyl]hydrazine |
| SMILES | COc1cccc(OC)c1C(NN)c1ncccc1Cl |
| InChI | InChI=1S/C14H16ClN3O2/c1-19-10-6-3-7-11(20-2)12(10)14(18-16)13-9(15)5-4-8-17-13/h3-8,14,18H,16H2,1-2H3 |
| InChIKey | OOUFGOLJGWZFHV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|