C15H16Cl2N2O2 — CID 105257162
[(3,4-dichlorophenyl)-(2,6-dimethoxyphenyl)methyl]hydrazine (PubChem CID 105257162) has the molecular formula C15H16Cl2N2O2 and a molecular weight of 327.21 g/mol. Its IUPAC name is [(3,4-dichlorophenyl)-(2,6-dimethoxyphenyl)methyl]hydrazine.
| Compound Name | [(3,4-dichlorophenyl)-(2,6-dimethoxyphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105257162 |
| Molecular Formula | C15H16Cl2N2O2 |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | [(3,4-dichlorophenyl)-(2,6-dimethoxyphenyl)methyl]hydrazine |
| SMILES | COc1cccc(OC)c1C(NN)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H16Cl2N2O2/c1-20-12-4-3-5-13(21-2)14(12)15(19-18)9-6-7-10(16)11(17)8-9/h3-8,15,19H,18H2,1-2H3 |
| InChIKey | FJZZMNSQYYSDTH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|