C15H18ClN3O2 — CID 105224204
5-chloro-2-[(2,6-dimethoxyphenyl)-hydrazinylmethyl]aniline (PubChem CID 105224204) has the molecular formula C15H18ClN3O2 and a molecular weight of 307.78 g/mol. Its IUPAC name is 5-chloro-2-[(2,6-dimethoxyphenyl)-hydrazinylmethyl]aniline.
| Compound Name | 5-chloro-2-[(2,6-dimethoxyphenyl)-hydrazinylmethyl]aniline |
|---|---|
| PubChem CID | 105224204 |
| Molecular Formula | C15H18ClN3O2 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 5-chloro-2-[(2,6-dimethoxyphenyl)-hydrazinylmethyl]aniline |
| SMILES | COc1cccc(OC)c1C(NN)c1ccc(Cl)cc1N |
| InChI | InChI=1S/C15H18ClN3O2/c1-20-12-4-3-5-13(21-2)14(12)15(19-18)10-7-6-9(16)8-11(10)17/h3-8,15,19H,17-18H2,1-2H3 |
| InChIKey | CFXMDINMIBTHFG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|