C14H13Cl2FN2O — CID 68510717
4-[1-(2,6-dichlorophenyl)ethoxy]-5-fluorobenzene-1,2-diamine (PubChem CID 68510717) has the molecular formula C14H13Cl2FN2O and a molecular weight of 315.18 g/mol. Its IUPAC name is 4-[1-(2,6-dichlorophenyl)ethoxy]-5-fluorobenzene-1,2-diamine.
| Compound Name | 4-[1-(2,6-dichlorophenyl)ethoxy]-5-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 68510717 |
| Molecular Formula | C14H13Cl2FN2O |
| Molecular Weight | 315.18 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 4-[1-(2,6-dichlorophenyl)ethoxy]-5-fluorobenzene-1,2-diamine |
| SMILES | CC(Oc1cc(N)c(N)cc1F)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H13Cl2FN2O/c1-7(14-8(15)3-2-4-9(14)16)20-13-6-12(19)11(18)5-10(13)17/h2-7H,18-19H2,1H3 |
| InChIKey | AYZJGIYIIIYNOP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.18 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|