C13H12FIN2O — CID 129390734
3-[(1S)-1-(5-fluoro-2-iodophenyl)ethoxy]pyridin-2-amine (PubChem CID 129390734) has the molecular formula C13H12FIN2O and a molecular weight of 358.15 g/mol. Its IUPAC name is 3-[(1S)-1-(5-fluoro-2-iodophenyl)ethoxy]pyridin-2-amine.
| Compound Name | 3-[(1S)-1-(5-fluoro-2-iodophenyl)ethoxy]pyridin-2-amine |
|---|---|
| PubChem CID | 129390734 |
| Molecular Formula | C13H12FIN2O |
| Molecular Weight | 358.15 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | 3-[(1S)-1-(5-fluoro-2-iodophenyl)ethoxy]pyridin-2-amine |
| SMILES | C[C@H](Oc1cccnc1N)c1cc(F)ccc1I |
| InChI | InChI=1S/C13H12FIN2O/c1-8(10-7-9(14)4-5-11(10)15)18-12-3-2-6-17-13(12)16/h2-8H,1H3,(H2,16,17)/t8-/m0/s1 |
| InChIKey | OYOAYUWCUQLRHK-QMMMGPOBSA-N |
| XLogP | 3.55 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.15 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|