C13H11ClF2N2O — CID 141397007
3-[(1S)-1-(2-chloro-3,6-difluorophenyl)ethoxy]pyridin-2-amine (PubChem CID 141397007) has the molecular formula C13H11ClF2N2O and a molecular weight of 284.69 g/mol. Its IUPAC name is 3-[(1S)-1-(2-chloro-3,6-difluorophenyl)ethoxy]pyridin-2-amine.
| Compound Name | 3-[(1S)-1-(2-chloro-3,6-difluorophenyl)ethoxy]pyridin-2-amine |
|---|---|
| PubChem CID | 141397007 |
| Molecular Formula | C13H11ClF2N2O |
| Molecular Weight | 284.69 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 3-[(1S)-1-(2-chloro-3,6-difluorophenyl)ethoxy]pyridin-2-amine |
| SMILES | C[C@H](Oc1cccnc1N)c1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C13H11ClF2N2O/c1-7(19-10-3-2-6-18-13(10)17)11-8(15)4-5-9(16)12(11)14/h2-7H,1H3,(H2,17,18)/t7-/m0/s1 |
| InChIKey | VGKKLQZCLZOZIR-ZETCQYMHSA-N |
| XLogP | 3.74 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.69 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|