C24H22Cl2N4O2 — CID 161236656
3-[(2,6-dichlorophenyl)methoxy]pyridin-2-amine;3-phenylmethoxypyridin-2-amine (PubChem CID 161236656) has the molecular formula C24H22Cl2N4O2 and a molecular weight of 469.37 g/mol. Its IUPAC name is 3-[(2,6-dichlorophenyl)methoxy]pyridin-2-amine;3-phenylmethoxypyridin-2-amine.
| Compound Name | 3-[(2,6-dichlorophenyl)methoxy]pyridin-2-amine;3-phenylmethoxypyridin-2-amine |
|---|---|
| PubChem CID | 161236656 |
| Molecular Formula | C24H22Cl2N4O2 |
| Molecular Weight | 469.37 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 3-[(2,6-dichlorophenyl)methoxy]pyridin-2-amine;3-phenylmethoxypyridin-2-amine |
| SMILES | Nc1ncccc1OCc1c(Cl)cccc1Cl.Nc1ncccc1OCc1ccccc1 |
| InChI | InChI=1S/C12H10Cl2N2O.C12H12N2O/c13-9-3-1-4-10(14)8(9)7-17-11-5-2-6-16-12(11)15;13-12-11(7-4-8-14-12)15-9-10-5-2-1-3-6-10/h1-6H,7H2,(H2,15,16);1-8H,9H2,(H2,13,14) |
| InChIKey | UZLOUOKNKPZUNK-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.37 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|