C24H23ClN4O2 — CID 161313048
3-[(2-chlorophenyl)methoxy]pyridin-2-amine;3-phenylmethoxypyridin-2-amine (PubChem CID 161313048) has the molecular formula C24H23ClN4O2 and a molecular weight of 434.93 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methoxy]pyridin-2-amine;3-phenylmethoxypyridin-2-amine.
| Compound Name | 3-[(2-chlorophenyl)methoxy]pyridin-2-amine;3-phenylmethoxypyridin-2-amine |
|---|---|
| PubChem CID | 161313048 |
| Molecular Formula | C24H23ClN4O2 |
| Molecular Weight | 434.93 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 3-[(2-chlorophenyl)methoxy]pyridin-2-amine;3-phenylmethoxypyridin-2-amine |
| SMILES | Nc1ncccc1OCc1ccccc1.Nc1ncccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C12H11ClN2O.C12H12N2O/c13-10-5-2-1-4-9(10)8-16-11-6-3-7-15-12(11)14;13-12-11(7-4-8-14-12)15-9-10-5-2-1-3-6-10/h1-7H,8H2,(H2,14,15);1-8H,9H2,(H2,13,14) |
| InChIKey | VJDJFFAFGVINGH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.93 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|