C28H32Cl2FN5O4 — CID 118555155
3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[6-morpholin-4-yl-5-(2-morpholin-4-ylethoxy)-3-pyridinyl]pyridin-2-amine (PubChem CID 118555155) has the molecular formula C28H32Cl2FN5O4 and a molecular weight of 592.50 g/mol. Its IUPAC name is 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[6-morpholin-4-yl-5-(2-morpholin-4-ylethoxy)-3-pyridinyl]pyridin-2-amine.
| Compound Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[6-morpholin-4-yl-5-(2-morpholin-4-ylethoxy)-3-pyridinyl]pyridin-2-amine |
|---|---|
| PubChem CID | 118555155 |
| Molecular Formula | C28H32Cl2FN5O4 |
| Molecular Weight | 592.50 g/mol |
| Exact Mass | 591.18 |
| IUPAC Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[6-morpholin-4-yl-5-(2-morpholin-4-ylethoxy)-3-pyridinyl]pyridin-2-amine |
| SMILES | CC(Oc1cc(-c2cnc(N3CCOCC3)c(OCCN3CCOCC3)c2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C28H32Cl2FN5O4/c1-18(25-21(29)2-3-22(31)26(25)30)40-23-14-19(16-33-27(23)32)20-15-24(39-13-6-35-4-9-37-10-5-35)28(34-17-20)36-7-11-38-12-8-36/h2-3,14-18H,4-13H2,1H3,(H2,32,33) |
| InChIKey | AJRYILCPHPUCAR-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|