C25H25ClF2N4O2 — CID 58886024
[4-[6-amino-5-[(2-chloro-3,6-difluorophenyl)methoxy]-3-pyridinyl]phenyl]-[(3S,5R)-3,5-dimethylpiperazin-1-yl]methanone (PubChem CID 58886024) has the molecular formula C25H25ClF2N4O2 and a molecular weight of 486.95 g/mol. Its IUPAC name is [4-[6-amino-5-[(2-chloro-3,6-difluorophenyl)methoxy]-3-pyridinyl]phenyl]-[(3S,5R)-3,5-dimethylpiperazin-1-yl]methanone.
| Compound Name | [4-[6-amino-5-[(2-chloro-3,6-difluorophenyl)methoxy]-3-pyridinyl]phenyl]-[(3S,5R)-3,5-dimethylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 58886024 |
| Molecular Formula | C25H25ClF2N4O2 |
| Molecular Weight | 486.95 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | [4-[6-amino-5-[(2-chloro-3,6-difluorophenyl)methoxy]-3-pyridinyl]phenyl]-[(3S,5R)-3,5-dimethylpiperazin-1-yl]methanone |
| SMILES | C[C@@H]1CN(C(=O)c2ccc(-c3cnc(N)c(OCc4c(F)ccc(F)c4Cl)c3)cc2)C[C@H](C)N1 |
| InChI | InChI=1S/C25H25ClF2N4O2/c1-14-11-32(12-15(2)31-14)25(33)17-5-3-16(4-6-17)18-9-22(24(29)30-10-18)34-13-19-20(27)7-8-21(28)23(19)26/h3-10,14-15,31H,11-13H2,1-2H3,(H2,29,30)/t14-,15+ |
| InChIKey | WIKQKPRCCMAFDF-GASCZTMLSA-N |
| XLogP | 4.66 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.95 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|