C24H23Cl2FN4O2 — CID 91589682
[4-[6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]-piperazin-1-ylmethanone (PubChem CID 91589682) has the molecular formula C24H23Cl2FN4O2 and a molecular weight of 489.38 g/mol. Its IUPAC name is [4-[6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]-piperazin-1-ylmethanone.
| Compound Name | [4-[6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 91589682 |
| Molecular Formula | C24H23Cl2FN4O2 |
| Molecular Weight | 489.38 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | [4-[6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]-piperazin-1-ylmethanone |
| SMILES | Nc1ncc(-c2ccc(C(=O)N3CCNCC3)cc2)cc1OCCc1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C24H23Cl2FN4O2/c25-19-5-6-20(27)22(26)18(19)7-12-33-21-13-17(14-30-23(21)28)15-1-3-16(4-2-15)24(32)31-10-8-29-9-11-31/h1-6,13-14,29H,7-12H2,(H2,28,30) |
| InChIKey | PHWHDMGQXBAWGV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.38 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|