C24H24Cl2FN3O2 — CID 91405872
4-[4-[6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]piperidin-4-ol (PubChem CID 91405872) has the molecular formula C24H24Cl2FN3O2 and a molecular weight of 476.38 g/mol. Its IUPAC name is 4-[4-[6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]piperidin-4-ol.
| Compound Name | 4-[4-[6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]piperidin-4-ol |
|---|---|
| PubChem CID | 91405872 |
| Molecular Formula | C24H24Cl2FN3O2 |
| Molecular Weight | 476.38 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 4-[4-[6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]piperidin-4-ol |
| SMILES | Nc1ncc(-c2ccc(C3(O)CCNCC3)cc2)cc1OCCc1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C24H24Cl2FN3O2/c25-19-5-6-20(27)22(26)18(19)7-12-32-21-13-16(14-30-23(21)28)15-1-3-17(4-2-15)24(31)8-10-29-11-9-24/h1-6,13-14,29,31H,7-12H2,(H2,28,30) |
| InChIKey | JQIGJOJTHOSNOO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.38 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|