C21H22ClF2N5O — CID 123322795
3-[2-(2-chloro-3,6-difluorophenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine (PubChem CID 123322795) has the molecular formula C21H22ClF2N5O and a molecular weight of 433.89 g/mol. Its IUPAC name is 3-[2-(2-chloro-3,6-difluorophenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine.
| Compound Name | 3-[2-(2-chloro-3,6-difluorophenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 123322795 |
| Molecular Formula | C21H22ClF2N5O |
| Molecular Weight | 433.89 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 3-[2-(2-chloro-3,6-difluorophenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine |
| SMILES | Nc1ncc(-c2cnn(C3CCNCC3)c2)cc1OCCc1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C21H22ClF2N5O/c22-20-16(17(23)1-2-18(20)24)5-8-30-19-9-13(10-27-21(19)25)14-11-28-29(12-14)15-3-6-26-7-4-15/h1-2,9-12,15,26H,3-8H2,(H2,25,27) |
| InChIKey | IGBUXNCXBKHNKK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.89 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|