C22H20Cl2FN7 — CID 141449973
3-[5-(2,6-dichloro-3-fluorophenyl)-1H-imidazol-2-yl]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine (PubChem CID 141449973) has the molecular formula C22H20Cl2FN7 and a molecular weight of 472.36 g/mol. Its IUPAC name is 3-[5-(2,6-dichloro-3-fluorophenyl)-1H-imidazol-2-yl]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine.
| Compound Name | 3-[5-(2,6-dichloro-3-fluorophenyl)-1H-imidazol-2-yl]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 141449973 |
| Molecular Formula | C22H20Cl2FN7 |
| Molecular Weight | 472.36 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 3-[5-(2,6-dichloro-3-fluorophenyl)-1H-imidazol-2-yl]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine |
| SMILES | Nc1ncc(-c2cnn(C3CCNCC3)c2)cc1-c1ncc(-c2c(Cl)ccc(F)c2Cl)[nH]1 |
| InChI | InChI=1S/C22H20Cl2FN7/c23-16-1-2-17(25)20(24)19(16)18-10-29-22(31-18)15-7-12(8-28-21(15)26)13-9-30-32(11-13)14-3-5-27-6-4-14/h1-2,7-11,14,27H,3-6H2,(H2,26,28)(H,29,31) |
| InChIKey | IZPREPADLRUOSH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 97.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.36 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|