C20H24Cl2FN3O3 — CID 175342332
7-[6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N-hydroxyheptanamide (PubChem CID 175342332) has the molecular formula C20H24Cl2FN3O3 and a molecular weight of 444.33 g/mol. Its IUPAC name is 7-[6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N-hydroxyheptanamide.
| Compound Name | 7-[6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N-hydroxyheptanamide |
|---|---|
| PubChem CID | 175342332 |
| Molecular Formula | C20H24Cl2FN3O3 |
| Molecular Weight | 444.33 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 7-[6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N-hydroxyheptanamide |
| SMILES | Nc1ncc(CCCCCCC(=O)NO)cc1OCCc1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C20H24Cl2FN3O3/c21-15-7-8-16(23)19(22)14(15)9-10-29-17-11-13(12-25-20(17)24)5-3-1-2-4-6-18(27)26-28/h7-8,11-12,28H,1-6,9-10H2,(H2,24,25)(H,26,27) |
| InChIKey | QZQJUPXZXMAFJX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.33 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|