C25H30Cl2FN5O3 — CID 91328440
1-[4-[6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-2-methylbut-3-yn-2-yl]-3-(2-morpholin-4-ylethyl)urea (PubChem CID 91328440) has the molecular formula C25H30Cl2FN5O3 and a molecular weight of 538.45 g/mol. Its IUPAC name is 1-[4-[6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-2-methylbut-3-yn-2-yl]-3-(2-morpholin-4-ylethyl)urea.
| Compound Name | 1-[4-[6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-2-methylbut-3-yn-2-yl]-3-(2-morpholin-4-ylethyl)urea |
|---|---|
| PubChem CID | 91328440 |
| Molecular Formula | C25H30Cl2FN5O3 |
| Molecular Weight | 538.45 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | 1-[4-[6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-2-methylbut-3-yn-2-yl]-3-(2-morpholin-4-ylethyl)urea |
| SMILES | CC(C)(C#Cc1cnc(N)c(OCCc2c(Cl)ccc(F)c2Cl)c1)NC(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C25H30Cl2FN5O3/c1-25(2,32-24(34)30-8-9-33-10-13-35-14-11-33)7-5-17-15-21(23(29)31-16-17)36-12-6-18-19(26)3-4-20(28)22(18)27/h3-4,15-16H,6,8-14H2,1-2H3,(H2,29,31)(H2,30,32,34) |
| InChIKey | BDPIECMBBSIFNB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|