C22H23Cl3N4O3S — CID 87480518
1-(2-morpholin-4-ylethyl)-3-[6-[2-(2,3,6-trichlorophenyl)ethoxy]-1,3-benzothiazol-2-yl]urea (PubChem CID 87480518) has the molecular formula C22H23Cl3N4O3S and a molecular weight of 529.88 g/mol. Its IUPAC name is 1-(2-morpholin-4-ylethyl)-3-[6-[2-(2,3,6-trichlorophenyl)ethoxy]-1,3-benzothiazol-2-yl]urea.
| Compound Name | 1-(2-morpholin-4-ylethyl)-3-[6-[2-(2,3,6-trichlorophenyl)ethoxy]-1,3-benzothiazol-2-yl]urea |
|---|---|
| PubChem CID | 87480518 |
| Molecular Formula | C22H23Cl3N4O3S |
| Molecular Weight | 529.88 g/mol |
| Exact Mass | 528.06 |
| IUPAC Name | 1-(2-morpholin-4-ylethyl)-3-[6-[2-(2,3,6-trichlorophenyl)ethoxy]-1,3-benzothiazol-2-yl]urea |
| SMILES | O=C(NCCN1CCOCC1)Nc1nc2ccc(OCCc3c(Cl)ccc(Cl)c3Cl)cc2s1 |
| InChI | InChI=1S/C22H23Cl3N4O3S/c23-16-2-3-17(24)20(25)15(16)5-10-32-14-1-4-18-19(13-14)33-22(27-18)28-21(30)26-6-7-29-8-11-31-12-9-29/h1-4,13H,5-12H2,(H2,26,27,28,30) |
| InChIKey | YEGJROZPPHVKBO-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.88 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|