C23H26Cl2FN5O2S — CID 87481443
1-[6-[1-(2,3-dichloro-6-fluorophenyl)ethoxy]-1,3-benzothiazol-2-yl]-3-[2-(4-methylpiperazin-1-yl)ethyl]urea (PubChem CID 87481443) has the molecular formula C23H26Cl2FN5O2S and a molecular weight of 526.47 g/mol. Its IUPAC name is 1-[6-[1-(2,3-dichloro-6-fluorophenyl)ethoxy]-1,3-benzothiazol-2-yl]-3-[2-(4-methylpiperazin-1-yl)ethyl]urea.
| Compound Name | 1-[6-[1-(2,3-dichloro-6-fluorophenyl)ethoxy]-1,3-benzothiazol-2-yl]-3-[2-(4-methylpiperazin-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 87481443 |
| Molecular Formula | C23H26Cl2FN5O2S |
| Molecular Weight | 526.47 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | 1-[6-[1-(2,3-dichloro-6-fluorophenyl)ethoxy]-1,3-benzothiazol-2-yl]-3-[2-(4-methylpiperazin-1-yl)ethyl]urea |
| SMILES | CC(Oc1ccc2nc(NC(=O)NCCN3CCN(C)CC3)sc2c1)c1c(F)ccc(Cl)c1Cl |
| InChI | InChI=1S/C23H26Cl2FN5O2S/c1-14(20-17(26)5-4-16(24)21(20)25)33-15-3-6-18-19(13-15)34-23(28-18)29-22(32)27-7-8-31-11-9-30(2)10-12-31/h3-6,13-14H,7-12H2,1-2H3,(H2,27,28,29,32) |
| InChIKey | OLYITTZOQZWEQC-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.47 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|