C23H25Cl2FN4O2S — CID 91065996
1-[6-[1-(2,3-dichloro-6-fluorophenyl)ethoxy]-1,3-benzothiazol-2-yl]-3-[2-(1-methylpyrrolidin-2-yl)ethyl]urea (PubChem CID 91065996) has the molecular formula C23H25Cl2FN4O2S and a molecular weight of 511.45 g/mol. Its IUPAC name is 1-[6-[1-(2,3-dichloro-6-fluorophenyl)ethoxy]-1,3-benzothiazol-2-yl]-3-[2-(1-methylpyrrolidin-2-yl)ethyl]urea.
| Compound Name | 1-[6-[1-(2,3-dichloro-6-fluorophenyl)ethoxy]-1,3-benzothiazol-2-yl]-3-[2-(1-methylpyrrolidin-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 91065996 |
| Molecular Formula | C23H25Cl2FN4O2S |
| Molecular Weight | 511.45 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | 1-[6-[1-(2,3-dichloro-6-fluorophenyl)ethoxy]-1,3-benzothiazol-2-yl]-3-[2-(1-methylpyrrolidin-2-yl)ethyl]urea |
| SMILES | CC(Oc1ccc2nc(NC(=O)NCCC3CCCN3C)sc2c1)c1c(F)ccc(Cl)c1Cl |
| InChI | InChI=1S/C23H25Cl2FN4O2S/c1-13(20-17(26)7-6-16(24)21(20)25)32-15-5-8-18-19(12-15)33-23(28-18)29-22(31)27-10-9-14-4-3-11-30(14)2/h5-8,12-14H,3-4,9-11H2,1-2H3,(H2,27,28,29,31) |
| InChIKey | GSPYCIFUHLCNRS-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.45 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|