C15H23FN4O3S — CID 125168777
1-[2-fluoro-5-(methanesulfonamido)phenyl]-3-[2-[(2R)-1-methylpyrrolidin-2-yl]ethyl]urea (PubChem CID 125168777) has the molecular formula C15H23FN4O3S and a molecular weight of 358.44 g/mol. Its IUPAC name is 1-[2-fluoro-5-(methanesulfonamido)phenyl]-3-[2-[(2R)-1-methylpyrrolidin-2-yl]ethyl]urea.
| Compound Name | 1-[2-fluoro-5-(methanesulfonamido)phenyl]-3-[2-[(2R)-1-methylpyrrolidin-2-yl]ethyl]urea |
|---|---|
| PubChem CID | 125168777 |
| Molecular Formula | C15H23FN4O3S |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1-[2-fluoro-5-(methanesulfonamido)phenyl]-3-[2-[(2R)-1-methylpyrrolidin-2-yl]ethyl]urea |
| SMILES | CN1CCC[C@@H]1CCNC(=O)Nc1cc(NS(C)(=O)=O)ccc1F |
| InChI | InChI=1S/C15H23FN4O3S/c1-20-9-3-4-12(20)7-8-17-15(21)18-14-10-11(5-6-13(14)16)19-24(2,22)23/h5-6,10,12,19H,3-4,7-9H2,1-2H3,(H2,17,18,21)/t12-/m1/s1 |
| InChIKey | STBZYLMEPCRDAV-GFCCVEGCSA-N |
| XLogP | 1.80 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |