C14H19ClFN3O — CID 72890023
1-(4-chloro-2-fluorophenyl)-3-[2-(1-methylpyrrolidin-2-yl)ethyl]urea (PubChem CID 72890023) has the molecular formula C14H19ClFN3O and a molecular weight of 299.78 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-3-[2-(1-methylpyrrolidin-2-yl)ethyl]urea.
| Compound Name | 1-(4-chloro-2-fluorophenyl)-3-[2-(1-methylpyrrolidin-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 72890023 |
| Molecular Formula | C14H19ClFN3O |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-3-[2-(1-methylpyrrolidin-2-yl)ethyl]urea |
| SMILES | CN1CCCC1CCNC(=O)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C14H19ClFN3O/c1-19-8-2-3-11(19)6-7-17-14(20)18-13-5-4-10(15)9-12(13)16/h4-5,9,11H,2-3,6-8H2,1H3,(H2,17,18,20) |
| InChIKey | WLSJNWDOPFVQDO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |