C15H20F3N3O2 — CID 72857196
1-[2-(1-methylpyrrolidin-2-yl)ethyl]-3-[2-(trifluoromethoxy)phenyl]urea (PubChem CID 72857196) has the molecular formula C15H20F3N3O2 and a molecular weight of 331.34 g/mol. Its IUPAC name is 1-[2-(1-methylpyrrolidin-2-yl)ethyl]-3-[2-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[2-(1-methylpyrrolidin-2-yl)ethyl]-3-[2-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 72857196 |
| Molecular Formula | C15H20F3N3O2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 1-[2-(1-methylpyrrolidin-2-yl)ethyl]-3-[2-(trifluoromethoxy)phenyl]urea |
| SMILES | CN1CCCC1CCNC(=O)Nc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C15H20F3N3O2/c1-21-10-4-5-11(21)8-9-19-14(22)20-12-6-2-3-7-13(12)23-15(16,17)18/h2-3,6-7,11H,4-5,8-10H2,1H3,(H2,19,20,22) |
| InChIKey | VDULGBBNMRPHID-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |