C16H22F3N3O3 — CID 125174751
1-[2-[(3S)-3-(hydroxymethyl)piperidin-1-yl]ethyl]-3-[2-(trifluoromethoxy)phenyl]urea (PubChem CID 125174751) has the molecular formula C16H22F3N3O3 and a molecular weight of 361.36 g/mol. Its IUPAC name is 1-[2-[(3S)-3-(hydroxymethyl)piperidin-1-yl]ethyl]-3-[2-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[2-[(3S)-3-(hydroxymethyl)piperidin-1-yl]ethyl]-3-[2-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 125174751 |
| Molecular Formula | C16H22F3N3O3 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 1-[2-[(3S)-3-(hydroxymethyl)piperidin-1-yl]ethyl]-3-[2-(trifluoromethoxy)phenyl]urea |
| SMILES | O=C(NCCN1CCC[C@H](CO)C1)Nc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C16H22F3N3O3/c17-16(18,19)25-14-6-2-1-5-13(14)21-15(24)20-7-9-22-8-3-4-12(10-22)11-23/h1-2,5-6,12,23H,3-4,7-11H2,(H2,20,21,24)/t12-/m0/s1 |
| InChIKey | FVTOOZQPUBNKFM-LBPRGKRZSA-N |
| XLogP | 2.41 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |