C18H27N3O5 — CID 125163719
methyl 3-[2-[(3S)-3-(hydroxymethyl)piperidin-1-yl]ethylcarbamoylamino]-4-methoxybenzoate (PubChem CID 125163719) has the molecular formula C18H27N3O5 and a molecular weight of 365.43 g/mol. Its IUPAC name is methyl 3-[2-[(3S)-3-(hydroxymethyl)piperidin-1-yl]ethylcarbamoylamino]-4-methoxybenzoate.
| Compound Name | methyl 3-[2-[(3S)-3-(hydroxymethyl)piperidin-1-yl]ethylcarbamoylamino]-4-methoxybenzoate |
|---|---|
| PubChem CID | 125163719 |
| Molecular Formula | C18H27N3O5 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | methyl 3-[2-[(3S)-3-(hydroxymethyl)piperidin-1-yl]ethylcarbamoylamino]-4-methoxybenzoate |
| SMILES | COC(=O)c1ccc(OC)c(NC(=O)NCCN2CCC[C@H](CO)C2)c1 |
| InChI | InChI=1S/C18H27N3O5/c1-25-16-6-5-14(17(23)26-2)10-15(16)20-18(24)19-7-9-21-8-3-4-13(11-21)12-22/h5-6,10,13,22H,3-4,7-9,11-12H2,1-2H3,(H2,19,20,24)/t13-/m0/s1 |
| InChIKey | VNQYJNPIBYACCV-ZDUSSCGKSA-N |
| XLogP | 1.31 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |