C16H31N3O2 — CID 164638769
1-(cyclohexylmethyl)-3-[2-[(3S)-3-(hydroxymethyl)piperidin-1-yl]ethyl]urea (PubChem CID 164638769) has the molecular formula C16H31N3O2 and a molecular weight of 297.44 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-3-[2-[(3S)-3-(hydroxymethyl)piperidin-1-yl]ethyl]urea.
| Compound Name | 1-(cyclohexylmethyl)-3-[2-[(3S)-3-(hydroxymethyl)piperidin-1-yl]ethyl]urea |
|---|---|
| PubChem CID | 164638769 |
| Molecular Formula | C16H31N3O2 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.24 |
| IUPAC Name | 1-(cyclohexylmethyl)-3-[2-[(3S)-3-(hydroxymethyl)piperidin-1-yl]ethyl]urea |
| SMILES | O=C(NCCN1CCC[C@H](CO)C1)NCC1CCCCC1 |
| InChI | InChI=1S/C16H31N3O2/c20-13-15-7-4-9-19(12-15)10-8-17-16(21)18-11-14-5-2-1-3-6-14/h14-15,20H,1-13H2,(H2,17,18,21)/t15-/m0/s1 |
| InChIKey | YLGQQISYRFFXSJ-HNNXBMFYSA-N |
| XLogP | 1.57 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |