C12H13F3N2O2 — CID 47201193
N-[2-(trifluoromethoxy)phenyl]pyrrolidine-1-carboxamide (PubChem CID 47201193) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is N-[2-(trifluoromethoxy)phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[2-(trifluoromethoxy)phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 47201193 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | N-[2-(trifluoromethoxy)phenyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1OC(F)(F)F)N1CCCC1 |
| InChI | InChI=1S/C12H13F3N2O2/c13-12(14,15)19-10-6-2-1-5-9(10)16-11(18)17-7-3-4-8-17/h1-2,5-6H,3-4,7-8H2,(H,16,18) |
| InChIKey | GTPWSYDCDJMIEL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |