C21H22F3N3O3 — CID 112825360
4-benzoyl-N-[2-(2,2,2-trifluoroethoxy)phenyl]-1,4-diazepane-1-carboxamide (PubChem CID 112825360) has the molecular formula C21H22F3N3O3 and a molecular weight of 421.42 g/mol. Its IUPAC name is 4-benzoyl-N-[2-(2,2,2-trifluoroethoxy)phenyl]-1,4-diazepane-1-carboxamide.
| Compound Name | 4-benzoyl-N-[2-(2,2,2-trifluoroethoxy)phenyl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 112825360 |
| Molecular Formula | C21H22F3N3O3 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 4-benzoyl-N-[2-(2,2,2-trifluoroethoxy)phenyl]-1,4-diazepane-1-carboxamide |
| SMILES | O=C(Nc1ccccc1OCC(F)(F)F)N1CCCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H22F3N3O3/c22-21(23,24)15-30-18-10-5-4-9-17(18)25-20(29)27-12-6-11-26(13-14-27)19(28)16-7-2-1-3-8-16/h1-5,7-10H,6,11-15H2,(H,25,29) |
| InChIKey | WDCRUDIZXBWEDM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |