C22H25F2N3O3 — CID 167969661
4-(4-fluorobenzoyl)-N-(5-fluoro-2-propoxyphenyl)-1,4-diazepane-1-carboxamide (PubChem CID 167969661) has the molecular formula C22H25F2N3O3 and a molecular weight of 417.46 g/mol. Its IUPAC name is 4-(4-fluorobenzoyl)-N-(5-fluoro-2-propoxyphenyl)-1,4-diazepane-1-carboxamide.
| Compound Name | 4-(4-fluorobenzoyl)-N-(5-fluoro-2-propoxyphenyl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 167969661 |
| Molecular Formula | C22H25F2N3O3 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 4-(4-fluorobenzoyl)-N-(5-fluoro-2-propoxyphenyl)-1,4-diazepane-1-carboxamide |
| SMILES | CCCOc1ccc(F)cc1NC(=O)N1CCCN(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H25F2N3O3/c1-2-14-30-20-9-8-18(24)15-19(20)25-22(29)27-11-3-10-26(12-13-27)21(28)16-4-6-17(23)7-5-16/h4-9,15H,2-3,10-14H2,1H3,(H,25,29) |
| InChIKey | MPMXDOIYGBINAD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |