C11H9F3N2O2 — CID 168520948
2-cyano-N-[2-(2,2,2-trifluoroethoxy)phenyl]acetamide (PubChem CID 168520948) has the molecular formula C11H9F3N2O2 and a molecular weight of 258.20 g/mol. Its IUPAC name is 2-cyano-N-[2-(2,2,2-trifluoroethoxy)phenyl]acetamide.
| Compound Name | 2-cyano-N-[2-(2,2,2-trifluoroethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 168520948 |
| Molecular Formula | C11H9F3N2O2 |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2-cyano-N-[2-(2,2,2-trifluoroethoxy)phenyl]acetamide |
| SMILES | N#CCC(=O)Nc1ccccc1OCC(F)(F)F |
| InChI | InChI=1S/C11H9F3N2O2/c12-11(13,14)7-18-9-4-2-1-3-8(9)16-10(17)5-6-15/h1-4H,5,7H2,(H,16,17) |
| InChIKey | PXUFZFHIFKMCSC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |