C12H11F3N2O2 — CID 168522088
2-cyano-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]acetamide (PubChem CID 168522088) has the molecular formula C12H11F3N2O2 and a molecular weight of 272.23 g/mol. Its IUPAC name is 2-cyano-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]acetamide.
| Compound Name | 2-cyano-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 168522088 |
| Molecular Formula | C12H11F3N2O2 |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2-cyano-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]acetamide |
| SMILES | Cc1ccc(NC(=O)CC#N)c(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F3N2O2/c1-8-2-3-9(17-11(18)4-5-16)10(6-8)19-7-12(13,14)15/h2-3,6H,4,7H2,1H3,(H,17,18) |
| InChIKey | KBRGAOXKAANILQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |